C18H26BrCl2F3N2 — CID 171278973
1-[(S)-[2-bromo-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171278973) has the molecular formula C18H26BrCl2F3N2 and a molecular weight of 478.22 g/mol. Its IUPAC name is 1-[(S)-[2-bromo-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-[2-bromo-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278973 |
| Molecular Formula | C18H26BrCl2F3N2 |
| Molecular Weight | 478.22 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-[(S)-[2-bromo-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1ccc(Br)c([C@H](C2CCCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H24BrF3N2.2ClH/c19-16-7-6-14(18(20,21)22)12-15(16)17(13-4-2-1-3-5-13)24-10-8-23-9-11-24;;/h6-7,12-13,17,23H,1-5,8-11H2;2*1H/t17-;;/m0../s1 |
| InChIKey | BYOWADKMJUYJMG-RMRYJAPISA-N |
| XLogP | 5.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.22 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |