C18H25Cl2F3N2 — CID 171171751
1-[(R)-[2-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;hydrochloride (PubChem CID 171171751) has the molecular formula C18H25Cl2F3N2 and a molecular weight of 397.31 g/mol. Its IUPAC name is 1-[(R)-[2-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-[2-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171751 |
| Molecular Formula | C18H25Cl2F3N2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[(R)-[2-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc(Cl)c([C@@H](C2CCCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H24ClF3N2.ClH/c19-16-7-6-14(18(20,21)22)12-15(16)17(13-4-2-1-3-5-13)24-10-8-23-9-11-24;/h6-7,12-13,17,23H,1-5,8-11H2;1H/t17-;/m1./s1 |
| InChIKey | KGWCDZKPMKVRCH-UNTBIKODSA-N |
| XLogP | 5.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |