C18H24F4N2 — CID 171165291
1-[(S)-cyclohexyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171165291) has the molecular formula C18H24F4N2 and a molecular weight of 344.40 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-cyclohexyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171165291 |
| Molecular Formula | C18H24F4N2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-[(S)-cyclohexyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | Fc1cc(C(F)(F)F)ccc1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C18H24F4N2/c19-16-12-14(18(20,21)22)6-7-15(16)17(13-4-2-1-3-5-13)24-10-8-23-9-11-24/h6-7,12-13,17,23H,1-5,8-11H2/t17-/m0/s1 |
| InChIKey | JCOHKXXWTQHZPP-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |