C18H25F3N2O — CID 171299054
2-[(S)-cyclohexyl(piperazin-1-yl)methyl]-4-(trifluoromethyl)phenol (PubChem CID 171299054) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]-4-(trifluoromethyl)phenol.
| Compound Name | 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171299054 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]-4-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C(F)(F)F)cc1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C18H25F3N2O/c19-18(20,21)14-6-7-16(24)15(12-14)17(13-4-2-1-3-5-13)23-10-8-22-9-11-23/h6-7,12-13,17,22,24H,1-5,8-11H2/t17-/m0/s1 |
| InChIKey | SGAYJMRCOLHFAO-KRWDZBQOSA-N |
| XLogP | 3.94 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|