C18H30Cl2N2 — CID 171283985
1-[(S)-cyclopentyl-(2,5-dimethylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171283985) has the molecular formula C18H30Cl2N2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(2,5-dimethylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl-(2,5-dimethylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283985 |
| Molecular Formula | C18H30Cl2N2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(S)-cyclopentyl-(2,5-dimethylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc(C)c([C@H](C2CCCC2)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C18H28N2.2ClH/c1-14-7-8-15(2)17(13-14)18(16-5-3-4-6-16)20-11-9-19-10-12-20;;/h7-8,13,16,18-19H,3-6,9-12H2,1-2H3;2*1H/t18-;;/m0../s1 |
| InChIKey | LBUIGYZXUUAQHO-NTEVMMBTSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |