C17H26N2 — CID 171280314
1-[(S)-cyclopentyl-(2-methylphenyl)methyl]piperazine (PubChem CID 171280314) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(2-methylphenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-(2-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171280314 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-[(S)-cyclopentyl-(2-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccccc1[C@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H26N2/c1-14-6-2-5-9-16(14)17(15-7-3-4-8-15)19-12-10-18-11-13-19/h2,5-6,9,15,17-18H,3-4,7-8,10-13H2,1H3/t17-/m0/s1 |
| InChIKey | XAQNWKXWKBONKM-KRWDZBQOSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |