C18H28N2O2 — CID 171273356
1-[(S)-cyclopentyl-(2,3-dimethoxyphenyl)methyl]piperazine (PubChem CID 171273356) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(2,3-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-(2,3-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171273356 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(S)-cyclopentyl-(2,3-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cccc([C@H](C2CCCC2)N2CCNCC2)c1OC |
| InChI | InChI=1S/C18H28N2O2/c1-21-16-9-5-8-15(18(16)22-2)17(14-6-3-4-7-14)20-12-10-19-11-13-20/h5,8-9,14,17,19H,3-4,6-7,10-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | ZYFNLNDUFBPICA-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |