C18H27ClN2O2 — CID 171288017
1-[(R)-(2-chloro-3,4-dimethoxyphenyl)-cyclopentylmethyl]piperazine (PubChem CID 171288017) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 1-[(R)-(2-chloro-3,4-dimethoxyphenyl)-cyclopentylmethyl]piperazine.
| Compound Name | 1-[(R)-(2-chloro-3,4-dimethoxyphenyl)-cyclopentylmethyl]piperazine |
|---|---|
| PubChem CID | 171288017 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-[(R)-(2-chloro-3,4-dimethoxyphenyl)-cyclopentylmethyl]piperazine |
| SMILES | COc1ccc([C@@H](C2CCCC2)N2CCNCC2)c(Cl)c1OC |
| InChI | InChI=1S/C18H27ClN2O2/c1-22-15-8-7-14(16(19)18(15)23-2)17(13-5-3-4-6-13)21-11-9-20-10-12-21/h7-8,13,17,20H,3-6,9-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | XJKQDKJEKLTZTR-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |