C17H27Cl3N2 — CID 171294012
1-[(R)-(4-chloro-2-methylphenyl)-cyclopentylmethyl]piperazine;dihydrochloride (PubChem CID 171294012) has the molecular formula C17H27Cl3N2 and a molecular weight of 365.78 g/mol. Its IUPAC name is 1-[(R)-(4-chloro-2-methylphenyl)-cyclopentylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(4-chloro-2-methylphenyl)-cyclopentylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294012 |
| Molecular Formula | C17H27Cl3N2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(R)-(4-chloro-2-methylphenyl)-cyclopentylmethyl]piperazine;dihydrochloride |
| SMILES | Cc1cc(Cl)ccc1[C@@H](C1CCCC1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H25ClN2.2ClH/c1-13-12-15(18)6-7-16(13)17(14-4-2-3-5-14)20-10-8-19-9-11-20;;/h6-7,12,14,17,19H,2-5,8-11H2,1H3;2*1H/t17-;;/m1../s1 |
| InChIKey | BIZQSTZHFHAFII-ZEECNFPPSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |