C17H22ClF3N2 — CID 171165357
1-[(S)-[4-chloro-2-(trifluoromethyl)phenyl]-cyclopentylmethyl]piperazine (PubChem CID 171165357) has the molecular formula C17H22ClF3N2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[(S)-[4-chloro-2-(trifluoromethyl)phenyl]-cyclopentylmethyl]piperazine.
| Compound Name | 1-[(S)-[4-chloro-2-(trifluoromethyl)phenyl]-cyclopentylmethyl]piperazine |
|---|---|
| PubChem CID | 171165357 |
| Molecular Formula | C17H22ClF3N2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(S)-[4-chloro-2-(trifluoromethyl)phenyl]-cyclopentylmethyl]piperazine |
| SMILES | FC(F)(F)c1cc(Cl)ccc1[C@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H22ClF3N2/c18-13-5-6-14(15(11-13)17(19,20)21)16(12-3-1-2-4-12)23-9-7-22-8-10-23/h5-6,11-12,16,22H,1-4,7-10H2/t16-/m0/s1 |
| InChIKey | AGHJVSLFECXGOH-INIZCTEOSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |