C17H26Cl3FN2 — CID 171275461
1-[(S)-(5-chloro-2-fluorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171275461) has the molecular formula C17H26Cl3FN2 and a molecular weight of 383.77 g/mol. Its IUPAC name is 1-[(S)-(5-chloro-2-fluorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(5-chloro-2-fluorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171275461 |
| Molecular Formula | C17H26Cl3FN2 |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[(S)-(5-chloro-2-fluorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(Cl)cc1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H24ClFN2.2ClH/c18-14-6-7-16(19)15(12-14)17(13-4-2-1-3-5-13)21-10-8-20-9-11-21;;/h6-7,12-13,17,20H,1-5,8-11H2;2*1H/t17-;;/m0../s1 |
| InChIKey | HLDOGAZXPOTWBE-RMRYJAPISA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |