C15H21ClFIN2 — CID 171181497
1-[(S)-cyclobutyl-(2-fluoro-5-iodophenyl)methyl]piperazine;hydrochloride (PubChem CID 171181497) has the molecular formula C15H21ClFIN2 and a molecular weight of 410.70 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(2-fluoro-5-iodophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-(2-fluoro-5-iodophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181497 |
| Molecular Formula | C15H21ClFIN2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 1-[(S)-cyclobutyl-(2-fluoro-5-iodophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(I)cc1[C@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C15H20FIN2.ClH/c16-14-5-4-12(17)10-13(14)15(11-2-1-3-11)19-8-6-18-7-9-19;/h4-5,10-11,15,18H,1-3,6-9H2;1H/t15-;/m0./s1 |
| InChIKey | HRLWUOQMZKDZPC-RSAXXLAASA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|