C15H20ClF3N2 — CID 171179692
1-[(S)-cyclobutyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 171179692) has the molecular formula C15H20ClF3N2 and a molecular weight of 320.79 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171179692 |
| Molecular Formula | C15H20ClF3N2 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(S)-cyclobutyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc([C@H](C2CCC2)N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C15H19F3N2.ClH/c16-12-5-4-11(13(17)14(12)18)15(10-2-1-3-10)20-8-6-19-7-9-20;/h4-5,10,15,19H,1-3,6-9H2;1H/t15-;/m0./s1 |
| InChIKey | LZSOCKOYFCGOMN-RSAXXLAASA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|