C15H22Cl2F2N2O — CID 171297572
6-[(S)-cyclobutyl(piperazin-1-yl)methyl]-2,3-difluorophenol;dihydrochloride (PubChem CID 171297572) has the molecular formula C15H22Cl2F2N2O and a molecular weight of 355.26 g/mol. Its IUPAC name is 6-[(S)-cyclobutyl(piperazin-1-yl)methyl]-2,3-difluorophenol;dihydrochloride.
| Compound Name | 6-[(S)-cyclobutyl(piperazin-1-yl)methyl]-2,3-difluorophenol;dihydrochloride |
|---|---|
| PubChem CID | 171297572 |
| Molecular Formula | C15H22Cl2F2N2O |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-[(S)-cyclobutyl(piperazin-1-yl)methyl]-2,3-difluorophenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c([C@H](C2CCC2)N2CCNCC2)ccc(F)c1F |
| InChI | InChI=1S/C15H20F2N2O.2ClH/c16-12-5-4-11(15(20)13(12)17)14(10-2-1-3-10)19-8-6-18-7-9-19;;/h4-5,10,14,18,20H,1-3,6-9H2;2*1H/t14-;;/m0../s1 |
| InChIKey | LMRWRVRPPMVLMC-UTLKBRERSA-N |
| XLogP | 3.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|