C17H24ClF3N2 — CID 171164946
1-[(S)-cyclohexyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 171164946) has the molecular formula C17H24ClF3N2 and a molecular weight of 348.84 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171164946 |
| Molecular Formula | C17H24ClF3N2 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(S)-cyclohexyl-(2,3,4-trifluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc([C@H](C2CCCCC2)N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C17H23F3N2.ClH/c18-14-7-6-13(15(19)16(14)20)17(12-4-2-1-3-5-12)22-10-8-21-9-11-22;/h6-7,12,17,21H,1-5,8-11H2;1H/t17-;/m0./s1 |
| InChIKey | JIDHGIHMFHVEMC-LMOVPXPDSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|