C16H21F3N2 — CID 171170017
1-[(R)-cyclopentyl-(2,3,6-trifluorophenyl)methyl]piperazine (PubChem CID 171170017) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-(2,3,6-trifluorophenyl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclopentyl-(2,3,6-trifluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171170017 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[(R)-cyclopentyl-(2,3,6-trifluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc(F)c([C@@H](C2CCCC2)N2CCNCC2)c1F |
| InChI | InChI=1S/C16H21F3N2/c17-12-5-6-13(18)15(19)14(12)16(11-3-1-2-4-11)21-9-7-20-8-10-21/h5-6,11,16,20H,1-4,7-10H2/t16-/m1/s1 |
| InChIKey | SUTBGGWXWRYXHK-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|