C15H20Cl2F2N2 — CID 171180317
1-[(S)-(3-chloro-2,6-difluorophenyl)-cyclobutylmethyl]piperazine;hydrochloride (PubChem CID 171180317) has the molecular formula C15H20Cl2F2N2 and a molecular weight of 337.24 g/mol. Its IUPAC name is 1-[(S)-(3-chloro-2,6-difluorophenyl)-cyclobutylmethyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(3-chloro-2,6-difluorophenyl)-cyclobutylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171180317 |
| Molecular Formula | C15H20Cl2F2N2 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[(S)-(3-chloro-2,6-difluorophenyl)-cyclobutylmethyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(Cl)c(F)c1[C@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C15H19ClF2N2.ClH/c16-11-4-5-12(17)13(14(11)18)15(10-2-1-3-10)20-8-6-19-7-9-20;/h4-5,10,15,19H,1-3,6-9H2;1H/t15-;/m0./s1 |
| InChIKey | CSGQEGSZIQHSBR-RSAXXLAASA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|