C15H19ClF2N2 — CID 171180450
1-[(S)-(2-chloro-3,6-difluorophenyl)-cyclobutylmethyl]piperazine (PubChem CID 171180450) has the molecular formula C15H19ClF2N2 and a molecular weight of 300.78 g/mol. Its IUPAC name is 1-[(S)-(2-chloro-3,6-difluorophenyl)-cyclobutylmethyl]piperazine.
| Compound Name | 1-[(S)-(2-chloro-3,6-difluorophenyl)-cyclobutylmethyl]piperazine |
|---|---|
| PubChem CID | 171180450 |
| Molecular Formula | C15H19ClF2N2 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[(S)-(2-chloro-3,6-difluorophenyl)-cyclobutylmethyl]piperazine |
| SMILES | Fc1ccc(F)c([C@H](C2CCC2)N2CCNCC2)c1Cl |
| InChI | InChI=1S/C15H19ClF2N2/c16-14-12(18)5-4-11(17)13(14)15(10-2-1-3-10)20-8-6-19-7-9-20/h4-5,10,15,19H,1-3,6-9H2/t15-/m0/s1 |
| InChIKey | RNANANMEZFOXPQ-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|