C17H23ClF2N2 — CID 171171500
1-[(R)-(3-chloro-2,6-difluorophenyl)-cyclohexylmethyl]piperazine (PubChem CID 171171500) has the molecular formula C17H23ClF2N2 and a molecular weight of 328.83 g/mol. Its IUPAC name is 1-[(R)-(3-chloro-2,6-difluorophenyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171171500 |
| Molecular Formula | C17H23ClF2N2 |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-cyclohexylmethyl]piperazine |
| SMILES | Fc1ccc(Cl)c(F)c1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H23ClF2N2/c18-13-6-7-14(19)15(16(13)20)17(12-4-2-1-3-5-12)22-10-8-21-9-11-22/h6-7,12,17,21H,1-5,8-11H2/t17-/m1/s1 |
| InChIKey | WAJNNUWJVMNMFY-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|