C16H21ClF2N2O — CID 171292469
1-[(R)-(3-chloro-2,6-difluorophenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171292469) has the molecular formula C16H21ClF2N2O and a molecular weight of 330.81 g/mol. Its IUPAC name is 1-[(R)-(3-chloro-2,6-difluorophenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171292469 |
| Molecular Formula | C16H21ClF2N2O |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | Fc1ccc(Cl)c(F)c1[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H21ClF2N2O/c17-12-1-2-13(18)14(15(12)19)16(11-3-9-22-10-4-11)21-7-5-20-6-8-21/h1-2,11,16,20H,3-10H2/t16-/m1/s1 |
| InChIKey | IBBLLDNQXXQFEL-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|