C15H17ClF4N2 — CID 171279971
1-[(S)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopropylmethyl]piperazine (PubChem CID 171279971) has the molecular formula C15H17ClF4N2 and a molecular weight of 336.76 g/mol. Its IUPAC name is 1-[(S)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopropylmethyl]piperazine.
| Compound Name | 1-[(S)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopropylmethyl]piperazine |
|---|---|
| PubChem CID | 171279971 |
| Molecular Formula | C15H17ClF4N2 |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[(S)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopropylmethyl]piperazine |
| SMILES | Fc1c(Cl)ccc(C(F)(F)F)c1[C@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C15H17ClF4N2/c16-11-4-3-10(15(18,19)20)12(13(11)17)14(9-1-2-9)22-7-5-21-6-8-22/h3-4,9,14,21H,1-2,5-8H2/t14-/m0/s1 |
| InChIKey | FKDMJYABJMLUQV-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |