C15H18BrF3N2O — CID 171301928
6-bromo-2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3-(trifluoromethyl)phenol (PubChem CID 171301928) has the molecular formula C15H18BrF3N2O and a molecular weight of 379.22 g/mol. Its IUPAC name is 6-bromo-2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3-(trifluoromethyl)phenol.
| Compound Name | 6-bromo-2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171301928 |
| Molecular Formula | C15H18BrF3N2O |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 6-bromo-2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3-(trifluoromethyl)phenol |
| SMILES | Oc1c(Br)ccc(C(F)(F)F)c1[C@@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C15H18BrF3N2O/c16-11-4-3-10(15(17,18)19)12(14(11)22)13(9-1-2-9)21-7-5-20-6-8-21/h3-4,9,13,20,22H,1-2,5-8H2/t13-/m1/s1 |
| InChIKey | MIUIXRWDLVNLLN-CYBMUJFWSA-N |
| XLogP | 3.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|