C15H20BrClN2O — CID 171299930
6-bromo-3-chloro-2-[(R)-cyclobutyl(piperazin-1-yl)methyl]phenol (PubChem CID 171299930) has the molecular formula C15H20BrClN2O and a molecular weight of 359.70 g/mol. Its IUPAC name is 6-bromo-3-chloro-2-[(R)-cyclobutyl(piperazin-1-yl)methyl]phenol.
| Compound Name | 6-bromo-3-chloro-2-[(R)-cyclobutyl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171299930 |
| Molecular Formula | C15H20BrClN2O |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 6-bromo-3-chloro-2-[(R)-cyclobutyl(piperazin-1-yl)methyl]phenol |
| SMILES | Oc1c(Br)ccc(Cl)c1[C@@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C15H20BrClN2O/c16-11-4-5-12(17)13(15(11)20)14(10-2-1-3-10)19-8-6-18-7-9-19/h4-5,10,14,18,20H,1-3,6-9H2/t14-/m1/s1 |
| InChIKey | JSVGKVLJLYNJTP-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|