C13H14BrF5N2O — CID 171299442
6-bromo-2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3-(trifluoromethyl)phenol (PubChem CID 171299442) has the molecular formula C13H14BrF5N2O and a molecular weight of 389.16 g/mol. Its IUPAC name is 6-bromo-2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3-(trifluoromethyl)phenol.
| Compound Name | 6-bromo-2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171299442 |
| Molecular Formula | C13H14BrF5N2O |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 6-bromo-2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-3-(trifluoromethyl)phenol |
| SMILES | Oc1c(Br)ccc(C(F)(F)F)c1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H14BrF5N2O/c14-8-2-1-7(13(17,18)19)9(11(8)22)10(12(15)16)21-5-3-20-4-6-21/h1-2,10,12,20,22H,3-6H2/t10-/m1/s1 |
| InChIKey | KDVBTRMORAITPM-SNVBAGLBSA-N |
| XLogP | 3.38 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|