C12H13BrF4N2O — CID 171301442
4-bromo-6-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-2,3-difluorophenol (PubChem CID 171301442) has the molecular formula C12H13BrF4N2O and a molecular weight of 357.15 g/mol. Its IUPAC name is 4-bromo-6-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-2,3-difluorophenol.
| Compound Name | 4-bromo-6-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 171301442 |
| Molecular Formula | C12H13BrF4N2O |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4-bromo-6-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-2,3-difluorophenol |
| SMILES | Oc1c([C@@H](C(F)F)N2CCNCC2)cc(Br)c(F)c1F |
| InChI | InChI=1S/C12H13BrF4N2O/c13-7-5-6(11(20)9(15)8(7)14)10(12(16)17)19-3-1-18-2-4-19/h5,10,12,18,20H,1-4H2/t10-/m0/s1 |
| InChIKey | RJXTUYUHAWPKNX-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|