C12H15F3N2O — CID 171273073
2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluorophenol (PubChem CID 171273073) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluorophenol.
| Compound Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluorophenol |
|---|---|
| PubChem CID | 171273073 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C12H15F3N2O/c13-9-3-1-2-8(11(9)18)10(12(14)15)17-6-4-16-5-7-17/h1-3,10,12,16,18H,4-7H2/t10-/m1/s1 |
| InChIKey | LMLLKZBACDLMHF-SNVBAGLBSA-N |
| XLogP | 1.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|