C12H14BrF3N2 — CID 171288489
1-[(1S)-1-(2-bromo-5-fluorophenyl)-2,2-difluoroethyl]piperazine (PubChem CID 171288489) has the molecular formula C12H14BrF3N2 and a molecular weight of 323.16 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromo-5-fluorophenyl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-bromo-5-fluorophenyl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 171288489 |
| Molecular Formula | C12H14BrF3N2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-[(1S)-1-(2-bromo-5-fluorophenyl)-2,2-difluoroethyl]piperazine |
| SMILES | Fc1ccc(Br)c([C@@H](C(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H14BrF3N2/c13-10-2-1-8(14)7-9(10)11(12(15)16)18-5-3-17-4-6-18/h1-2,7,11-12,17H,3-6H2/t11-/m0/s1 |
| InChIKey | ANNFIOUEDAVPKE-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |