C12H14Br2F2N2 — CID 171283601
1-[(1R)-1-(2,5-dibromophenyl)-2,2-difluoroethyl]piperazine (PubChem CID 171283601) has the molecular formula C12H14Br2F2N2 and a molecular weight of 384.06 g/mol. Its IUPAC name is 1-[(1R)-1-(2,5-dibromophenyl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,5-dibromophenyl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 171283601 |
| Molecular Formula | C12H14Br2F2N2 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | 1-[(1R)-1-(2,5-dibromophenyl)-2,2-difluoroethyl]piperazine |
| SMILES | FC(F)[C@@H](c1cc(Br)ccc1Br)N1CCNCC1 |
| InChI | InChI=1S/C12H14Br2F2N2/c13-8-1-2-10(14)9(7-8)11(12(15)16)18-5-3-17-4-6-18/h1-2,7,11-12,17H,3-6H2/t11-/m1/s1 |
| InChIKey | IQBDCCUOYUJXLO-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |