C12H16F2N2O2 — CID 171287413
2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,4-diol (PubChem CID 171287413) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,4-diol.
| Compound Name | 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 171287413 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c([C@@H](C(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H16F2N2O2/c13-12(14)11(16-5-3-15-4-6-16)9-7-8(17)1-2-10(9)18/h1-2,7,11-12,15,17-18H,3-6H2/t11-/m0/s1 |
| InChIKey | WHXUIIPCSHYGPR-NSHDSACASA-N |
| XLogP | 1.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|