C12H16ClF3N2O2 — CID 171175445
2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,4-diol;hydrochloride (PubChem CID 171175445) has the molecular formula C12H16ClF3N2O2 and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,4-diol;hydrochloride.
| Compound Name | 2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,4-diol;hydrochloride |
|---|---|
| PubChem CID | 171175445 |
| Molecular Formula | C12H16ClF3N2O2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,4-diol;hydrochloride |
| SMILES | Cl.Oc1ccc(O)c([C@H](N2CCNCC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O2.ClH/c13-12(14,15)11(17-5-3-16-4-6-17)9-7-8(18)1-2-10(9)19;/h1-2,7,11,16,18-19H,3-6H2;1H/t11-;/m0./s1 |
| InChIKey | OWMXCWAQSMDISE-MERQFXBCSA-N |
| XLogP | 2.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|