C12H15F3N2O2 — CID 171178759
3-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,2-diol (PubChem CID 171178759) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,2-diol.
| Compound Name | 3-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 171178759 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]benzene-1,2-diol |
| SMILES | Oc1cccc([C@@H](N2CCNCC2)C(F)(F)F)c1O |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)11(17-6-4-16-5-7-17)8-2-1-3-9(18)10(8)19/h1-3,11,16,18-19H,4-7H2/t11-/m1/s1 |
| InChIKey | RIAFMOYQSLUWNL-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|