C12H14ClF3N2 — CID 171180957
1-[(1R)-1-(2-chlorophenyl)-2,2,2-trifluoroethyl]piperazine (PubChem CID 171180957) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-[(1R)-1-(2-chlorophenyl)-2,2,2-trifluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-chlorophenyl)-2,2,2-trifluoroethyl]piperazine |
|---|---|
| PubChem CID | 171180957 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(1R)-1-(2-chlorophenyl)-2,2,2-trifluoroethyl]piperazine |
| SMILES | FC(F)(F)[C@@H](c1ccccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H14ClF3N2/c13-10-4-2-1-3-9(10)11(12(14,15)16)18-7-5-17-6-8-18/h1-4,11,17H,5-8H2/t11-/m1/s1 |
| InChIKey | ZLKUBLAFJXVORU-LLVKDONJSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |