C11H15Cl3F3N3 — CID 171285753
1-[(1S)-1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride (PubChem CID 171285753) has the molecular formula C11H15Cl3F3N3 and a molecular weight of 352.62 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171285753 |
| Molecular Formula | C11H15Cl3F3N3 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)[C@H](c1cccnc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C11H13ClF3N3.2ClH/c12-10-8(2-1-3-17-10)9(11(13,14)15)18-6-4-16-5-7-18;;/h1-3,9,16H,4-7H2;2*1H/t9-;;/m0../s1 |
| InChIKey | ACUZKOPZAFGYDR-WWPIYYJJSA-N |
| XLogP | 3.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|