C14H19ClF3N3 — CID 171294528
3-chloro-N,N-dimethyl-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]aniline (PubChem CID 171294528) has the molecular formula C14H19ClF3N3 and a molecular weight of 321.77 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]aniline.
| Compound Name | 3-chloro-N,N-dimethyl-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]aniline |
|---|---|
| PubChem CID | 171294528 |
| Molecular Formula | C14H19ClF3N3 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]aniline |
| SMILES | CN(C)c1ccc([C@H](N2CCNCC2)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClF3N3/c1-20(2)10-3-4-11(12(15)9-10)13(14(16,17)18)21-7-5-19-6-8-21/h3-4,9,13,19H,5-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | IMNSXQIFYPVBQO-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|