C15H23Cl3F3N3 — CID 171304007
3-chloro-N,N-dimethyl-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride (PubChem CID 171304007) has the molecular formula C15H23Cl3F3N3 and a molecular weight of 408.72 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride.
| Compound Name | 3-chloro-N,N-dimethyl-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171304007 |
| Molecular Formula | C15H23Cl3F3N3 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride |
| SMILES | CN(C)c1ccc([C@@H](CC(F)(F)F)N2CCNCC2)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C15H21ClF3N3.2ClH/c1-21(2)11-3-4-12(13(16)9-11)14(10-15(17,18)19)22-7-5-20-6-8-22;;/h3-4,9,14,20H,5-8,10H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | XLFDSCAUPDTAAH-FMOMHUKBSA-N |
| XLogP | 4.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|