C16H23ClF3N3 — CID 171304008
3-chloro-N,N-dimethyl-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline (PubChem CID 171304008) has the molecular formula C16H23ClF3N3 and a molecular weight of 349.83 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline.
| Compound Name | 3-chloro-N,N-dimethyl-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline |
|---|---|
| PubChem CID | 171304008 |
| Molecular Formula | C16H23ClF3N3 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline |
| SMILES | CN(C)c1ccc([C@@H](CCC(F)(F)F)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClF3N3/c1-22(2)12-3-4-13(14(17)11-12)15(5-6-16(18,19)20)23-9-7-21-8-10-23/h3-4,11,15,21H,5-10H2,1-2H3/t15-/m1/s1 |
| InChIKey | IVXGOTQQPLDRFZ-OAHLLOKOSA-N |
| XLogP | 3.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|