C17H28Cl3N3 — CID 171294553
3-chloro-4-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-dimethylaniline;dihydrochloride (PubChem CID 171294553) has the molecular formula C17H28Cl3N3 and a molecular weight of 380.79 g/mol. Its IUPAC name is 3-chloro-4-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-dimethylaniline;dihydrochloride.
| Compound Name | 3-chloro-4-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-dimethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 171294553 |
| Molecular Formula | C17H28Cl3N3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-chloro-4-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]-N,N-dimethylaniline;dihydrochloride |
| SMILES | CN(C)c1ccc([C@@H](CC2CC2)N2CCNCC2)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C17H26ClN3.2ClH/c1-20(2)14-5-6-15(16(18)12-14)17(11-13-3-4-13)21-9-7-19-8-10-21;;/h5-6,12-13,17,19H,3-4,7-11H2,1-2H3;2*1H/t17-;;/m1../s1 |
| InChIKey | CACDEFWIJMJGCI-ZEECNFPPSA-N |
| XLogP | 4.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|