C12H18Cl2F2N2O2 — CID 171272474
4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,2-diol;dihydrochloride (PubChem CID 171272474) has the molecular formula C12H18Cl2F2N2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,2-diol;dihydrochloride.
| Compound Name | 4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 171272474 |
| Molecular Formula | C12H18Cl2F2N2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]benzene-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc([C@H](C(F)F)N2CCNCC2)cc1O |
| InChI | InChI=1S/C12H16F2N2O2.2ClH/c13-12(14)11(16-5-3-15-4-6-16)8-1-2-9(17)10(18)7-8;;/h1-2,7,11-12,15,17-18H,3-6H2;2*1H/t11-;;/m1../s1 |
| InChIKey | YKWXQHAALACGNV-NVJADKKVSA-N |
| XLogP | 2.15 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|