C12H17Cl2F2IN2 — CID 171276033
1-[(1R)-2,2-difluoro-1-(4-iodophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171276033) has the molecular formula C12H17Cl2F2IN2 and a molecular weight of 425.09 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-(4-iodophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-difluoro-1-(4-iodophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171276033 |
| Molecular Formula | C12H17Cl2F2IN2 |
| Molecular Weight | 425.09 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-(4-iodophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)[C@@H](c1ccc(I)cc1)N1CCNCC1 |
| InChI | InChI=1S/C12H15F2IN2.2ClH/c13-12(14)11(17-7-5-16-6-8-17)9-1-3-10(15)4-2-9;;/h1-4,11-12,16H,5-8H2;2*1H/t11-;;/m1../s1 |
| InChIKey | GNJSIRONEHORBJ-NVJADKKVSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.09 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|