C13H18F2N2S — CID 171294567
1-[(1S)-2,2-difluoro-1-(4-methylsulfanylphenyl)ethyl]piperazine (PubChem CID 171294567) has the molecular formula C13H18F2N2S and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluoro-1-(4-methylsulfanylphenyl)ethyl]piperazine.
| Compound Name | 1-[(1S)-2,2-difluoro-1-(4-methylsulfanylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171294567 |
| Molecular Formula | C13H18F2N2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(1S)-2,2-difluoro-1-(4-methylsulfanylphenyl)ethyl]piperazine |
| SMILES | CSc1ccc([C@@H](C(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C13H18F2N2S/c1-18-11-4-2-10(3-5-11)12(13(14)15)17-8-6-16-7-9-17/h2-5,12-13,16H,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | PDAVHKZCOFJSCV-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |