C10H16Cl2F2N2S — CID 171280730
1-[(1R)-2,2-difluoro-1-thiophen-3-ylethyl]piperazine;dihydrochloride (PubChem CID 171280730) has the molecular formula C10H16Cl2F2N2S and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-thiophen-3-ylethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-difluoro-1-thiophen-3-ylethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280730 |
| Molecular Formula | C10H16Cl2F2N2S |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-thiophen-3-ylethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)[C@@H](c1ccsc1)N1CCNCC1 |
| InChI | InChI=1S/C10H14F2N2S.2ClH/c11-10(12)9(8-1-6-15-7-8)14-4-2-13-3-5-14;;/h1,6-7,9-10,13H,2-5H2;2*1H/t9-;;/m1../s1 |
| InChIKey | NVEQLQLEDACNHP-KLQYNRQASA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |