C18H30Cl2N2S — CID 171281956
1-[(S)-cyclohexyl-(4-methylsulfanylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171281956) has the molecular formula C18H30Cl2N2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(4-methylsulfanylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-(4-methylsulfanylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281956 |
| Molecular Formula | C18H30Cl2N2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[(S)-cyclohexyl-(4-methylsulfanylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | CSc1ccc([C@H](C2CCCCC2)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H28N2S.2ClH/c1-21-17-9-7-16(8-10-17)18(15-5-3-2-4-6-15)20-13-11-19-12-14-20;;/h7-10,15,18-19H,2-6,11-14H2,1H3;2*1H/t18-;;/m0../s1 |
| InChIKey | ZWYFSCJGIDQQCR-NTEVMMBTSA-N |
| XLogP | 4.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |