C17H26Br2Cl2N2 — CID 171283650
1-[(S)-cyclohexyl-(3,4-dibromophenyl)methyl]piperazine;dihydrochloride (PubChem CID 171283650) has the molecular formula C17H26Br2Cl2N2 and a molecular weight of 489.12 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(3,4-dibromophenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-(3,4-dibromophenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283650 |
| Molecular Formula | C17H26Br2Cl2N2 |
| Molecular Weight | 489.12 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | 1-[(S)-cyclohexyl-(3,4-dibromophenyl)methyl]piperazine;dihydrochloride |
| SMILES | Brc1ccc([C@H](C2CCCCC2)N2CCNCC2)cc1Br.Cl.Cl |
| InChI | InChI=1S/C17H24Br2N2.2ClH/c18-15-7-6-14(12-16(15)19)17(13-4-2-1-3-5-13)21-10-8-20-9-11-21;;/h6-7,12-13,17,20H,1-5,8-11H2;2*1H/t17-;;/m0../s1 |
| InChIKey | DCDSYFNHPILALT-RMRYJAPISA-N |
| XLogP | 5.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.12 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |