C20H28Cl2N2 — CID 171274893
1-[(S)-cyclopentyl(naphthalen-2-yl)methyl]piperazine;dihydrochloride (PubChem CID 171274893) has the molecular formula C20H28Cl2N2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl(naphthalen-2-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl(naphthalen-2-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274893 |
| Molecular Formula | C20H28Cl2N2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(S)-cyclopentyl(naphthalen-2-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2cc([C@H](C3CCCC3)N3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C20H26N2.2ClH/c1-4-8-18-15-19(10-9-16(18)5-1)20(17-6-2-3-7-17)22-13-11-21-12-14-22;;/h1,4-5,8-10,15,17,20-21H,2-3,6-7,11-14H2;2*1H/t20-;;/m0../s1 |
| InChIKey | GNYMNADNMSPIMJ-FJSYBICCSA-N |
| XLogP | 4.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |