C16H22F2N2 — CID 95483787
1-[(S)-cyclopentyl-(3,4-difluorophenyl)methyl]piperazine (PubChem CID 95483787) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(3,4-difluorophenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-(3,4-difluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 95483787 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[(S)-cyclopentyl-(3,4-difluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc([C@H](C2CCCC2)N2CCNCC2)cc1F |
| InChI | InChI=1S/C16H22F2N2/c17-14-6-5-13(11-15(14)18)16(12-3-1-2-4-12)20-9-7-19-8-10-20/h5-6,11-12,16,19H,1-4,7-10H2/t16-/m0/s1 |
| InChIKey | QKMLYIZLOPNHON-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |