C18H29Cl2FN2O — CID 171287647
1-[(R)-cyclohexyl-(3-fluoro-4-methoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171287647) has the molecular formula C18H29Cl2FN2O and a molecular weight of 379.35 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-(3-fluoro-4-methoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclohexyl-(3-fluoro-4-methoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287647 |
| Molecular Formula | C18H29Cl2FN2O |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(R)-cyclohexyl-(3-fluoro-4-methoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@@H](C2CCCCC2)N2CCNCC2)cc1F.Cl.Cl |
| InChI | InChI=1S/C18H27FN2O.2ClH/c1-22-17-8-7-15(13-16(17)19)18(14-5-3-2-4-6-14)21-11-9-20-10-12-21;;/h7-8,13-14,18,20H,2-6,9-12H2,1H3;2*1H/t18-;;/m1../s1 |
| InChIKey | IGWZEMOKBHJDOB-JPKZNVRTSA-N |
| XLogP | 4.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |