C17H22F4N2 — CID 171171716
1-[(R)-cyclopentyl-[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171171716) has the molecular formula C17H22F4N2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-cyclopentyl-[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171171716 |
| Molecular Formula | C17H22F4N2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[(R)-cyclopentyl-[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | Fc1cc([C@@H](C2CCCC2)N2CCNCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H22F4N2/c18-15-11-13(5-6-14(15)17(19,20)21)16(12-3-1-2-4-12)23-9-7-22-8-10-23/h5-6,11-12,16,22H,1-4,7-10H2/t16-/m1/s1 |
| InChIKey | RWHLMFRKJXVADF-MRXNPFEDSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |