C16H20ClF3N2 — CID 171180022
1-[(S)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethyl]piperazine (PubChem CID 171180022) has the molecular formula C16H20ClF3N2 and a molecular weight of 332.80 g/mol. Its IUPAC name is 1-[(S)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethyl]piperazine.
| Compound Name | 1-[(S)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethyl]piperazine |
|---|---|
| PubChem CID | 171180022 |
| Molecular Formula | C16H20ClF3N2 |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[(S)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethyl]piperazine |
| SMILES | FC(F)(F)c1cc([C@H](C2CCC2)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C16H20ClF3N2/c17-14-5-4-12(10-13(14)16(18,19)20)15(11-2-1-3-11)22-8-6-21-7-9-22/h4-5,10-11,15,21H,1-3,6-9H2/t15-/m0/s1 |
| InChIKey | YFJQAVKGQPAVGT-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |