C16H24Cl4N2 — CID 171274925
1-[(S)-cyclopentyl-(3,4-dichlorophenyl)methyl]piperazine;dihydrochloride (PubChem CID 171274925) has the molecular formula C16H24Cl4N2 and a molecular weight of 386.19 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(3,4-dichlorophenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl-(3,4-dichlorophenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274925 |
| Molecular Formula | C16H24Cl4N2 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-[(S)-cyclopentyl-(3,4-dichlorophenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc([C@H](C2CCCC2)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N2.2ClH/c17-14-6-5-13(11-15(14)18)16(12-3-1-2-4-12)20-9-7-19-8-10-20;;/h5-6,11-12,16,19H,1-4,7-10H2;2*1H/t16-;;/m0../s1 |
| InChIKey | VVNGSBIFLFSAFJ-SQKCAUCHSA-N |
| XLogP | 4.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |