C16H26Cl2N2O — CID 171285185
4-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol;dihydrochloride (PubChem CID 171285185) has the molecular formula C16H26Cl2N2O and a molecular weight of 333.30 g/mol. Its IUPAC name is 4-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol;dihydrochloride.
| Compound Name | 4-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171285185 |
| Molecular Formula | C16H26Cl2N2O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc([C@@H](C2CCCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H24N2O.2ClH/c19-15-7-5-14(6-8-15)16(13-3-1-2-4-13)18-11-9-17-10-12-18;;/h5-8,13,16-17,19H,1-4,9-12H2;2*1H/t16-;;/m1../s1 |
| InChIKey | OUXUYBLMNTXRGF-GGMCWBHBSA-N |
| XLogP | 3.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |